C9H8BrCl3O2 — CID 171861198
3-bromo-1-(2,3,6-trichlorophenyl)propane-1,2-diol (PubChem CID 171861198) has the molecular formula C9H8BrCl3O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-bromo-1-(2,3,6-trichlorophenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(2,3,6-trichlorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861198 |
| Molecular Formula | C9H8BrCl3O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | 3-bromo-1-(2,3,6-trichlorophenyl)propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H8BrCl3O2/c10-3-6(14)9(15)7-4(11)1-2-5(12)8(7)13/h1-2,6,9,14-15H,3H2 |
| InChIKey | UXUIXJXSLXLLNO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|