C9H10BrClO3 — CID 171859575
3-bromo-1-(2-chloro-4-hydroxyphenyl)propane-1,2-diol (PubChem CID 171859575) has the molecular formula C9H10BrClO3 and a molecular weight of 281.53 g/mol. Its IUPAC name is 3-bromo-1-(2-chloro-4-hydroxyphenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(2-chloro-4-hydroxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171859575 |
| Molecular Formula | C9H10BrClO3 |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 3-bromo-1-(2-chloro-4-hydroxyphenyl)propane-1,2-diol |
| SMILES | Oc1ccc(C(O)C(O)CBr)c(Cl)c1 |
| InChI | InChI=1S/C9H10BrClO3/c10-4-8(13)9(14)6-2-1-5(12)3-7(6)11/h1-3,8-9,12-14H,4H2 |
| InChIKey | VZWXVRGTSWWMFW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|