C10H12BrClO3 — CID 171859874
3-bromo-1-(5-chloro-2-hydroxy-3-methylphenyl)propane-1,2-diol (PubChem CID 171859874) has the molecular formula C10H12BrClO3 and a molecular weight of 295.56 g/mol. Its IUPAC name is 3-bromo-1-(5-chloro-2-hydroxy-3-methylphenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(5-chloro-2-hydroxy-3-methylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171859874 |
| Molecular Formula | C10H12BrClO3 |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 3-bromo-1-(5-chloro-2-hydroxy-3-methylphenyl)propane-1,2-diol |
| SMILES | Cc1cc(Cl)cc(C(O)C(O)CBr)c1O |
| InChI | InChI=1S/C10H12BrClO3/c1-5-2-6(12)3-7(9(5)14)10(15)8(13)4-11/h2-3,8,10,13-15H,4H2,1H3 |
| InChIKey | KVPZDCIUUQIMLV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|