C15H20O4 — CID 162744144
1-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]pent-4-en-2-ol (PubChem CID 162744144) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]pent-4-en-2-ol.
| Compound Name | 1-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]pent-4-en-2-ol |
|---|---|
| PubChem CID | 162744144 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[(6-propan-2-yl-1,3-benzodioxol-5-yl)oxy]pent-4-en-2-ol |
| SMILES | C=CCC(O)COc1cc2c(cc1C(C)C)OCO2 |
| InChI | InChI=1S/C15H20O4/c1-4-5-11(16)8-17-13-7-15-14(18-9-19-15)6-12(13)10(2)3/h4,6-7,10-11,16H,1,5,8-9H2,2-3H3 |
| InChIKey | CZXXYGRSJCJEKL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|