C25H28N2O3 — CID 137306969
4-[6-(butan-2-ylamino)-4-(2-prop-2-enoxyphenyl)-2-pyridinyl]-2-methoxyphenol (PubChem CID 137306969) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[6-(butan-2-ylamino)-4-(2-prop-2-enoxyphenyl)-2-pyridinyl]-2-methoxyphenol.
| Compound Name | 4-[6-(butan-2-ylamino)-4-(2-prop-2-enoxyphenyl)-2-pyridinyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 137306969 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 4-[6-(butan-2-ylamino)-4-(2-prop-2-enoxyphenyl)-2-pyridinyl]-2-methoxyphenol |
| SMILES | C=CCOc1ccccc1-c1cc(NC(C)CC)nc(-c2ccc(O)c(OC)c2)c1 |
| InChI | InChI=1S/C25H28N2O3/c1-5-13-30-23-10-8-7-9-20(23)19-14-21(27-25(16-19)26-17(3)6-2)18-11-12-22(28)24(15-18)29-4/h5,7-12,14-17,28H,1,6,13H2,2-4H3,(H,26,27) |
| InChIKey | RUWNJJHJEZJBQW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|