C24H22N4O2 — CID 135525328
2-methoxy-4-[6-[[(1R)-1-(4-pyridin-3-ylphenyl)ethyl]amino]pyrazin-2-yl]phenol (PubChem CID 135525328) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-methoxy-4-[6-[[(1R)-1-(4-pyridin-3-ylphenyl)ethyl]amino]pyrazin-2-yl]phenol.
| Compound Name | 2-methoxy-4-[6-[[(1R)-1-(4-pyridin-3-ylphenyl)ethyl]amino]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 135525328 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-methoxy-4-[6-[[(1R)-1-(4-pyridin-3-ylphenyl)ethyl]amino]pyrazin-2-yl]phenol |
| SMILES | COc1cc(-c2cncc(N[C@H](C)c3ccc(-c4cccnc4)cc3)n2)ccc1O |
| InChI | InChI=1S/C24H22N4O2/c1-16(17-5-7-18(8-6-17)20-4-3-11-25-13-20)27-24-15-26-14-21(28-24)19-9-10-22(29)23(12-19)30-2/h3-16,29H,1-2H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | XYELFVFIXOYHKD-MRXNPFEDSA-N |
| XLogP | 5.09 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |