C18H15ClFN3 — CID 58717096
6-(3-chloro-4-fluorophenyl)-N-[(1S)-1-phenylethyl]pyrazin-2-amine (PubChem CID 58717096) has the molecular formula C18H15ClFN3 and a molecular weight of 327.79 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-N-[(1S)-1-phenylethyl]pyrazin-2-amine.
| Compound Name | 6-(3-chloro-4-fluorophenyl)-N-[(1S)-1-phenylethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 58717096 |
| Molecular Formula | C18H15ClFN3 |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-N-[(1S)-1-phenylethyl]pyrazin-2-amine |
| SMILES | C[C@H](Nc1cncc(-c2ccc(F)c(Cl)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C18H15ClFN3/c1-12(13-5-3-2-4-6-13)22-18-11-21-10-17(23-18)14-7-8-16(20)15(19)9-14/h2-12H,1H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | RFIUIAZAFIACRE-LBPRGKRZSA-N |
| XLogP | 5.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |