C25H26N4O2 — CID 158200755
methane;2-methoxy-4-[6-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazin-2-yl]phenol (PubChem CID 158200755) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is methane;2-methoxy-4-[6-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazin-2-yl]phenol.
| Compound Name | methane;2-methoxy-4-[6-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 158200755 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | methane;2-methoxy-4-[6-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazin-2-yl]phenol |
| SMILES | C.COc1cc(-c2cncc(NC(C)c3ccc(-c4cccnc4)cc3)n2)ccc1O |
| InChI | InChI=1S/C24H22N4O2.CH4/c1-16(17-5-7-18(8-6-17)20-4-3-11-25-13-20)27-24-15-26-14-21(28-24)19-9-10-22(29)23(12-19)30-2;/h3-16,29H,1-2H3,(H,27,28);1H4 |
| InChIKey | GAXBDUHFPDQMAS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |