C18H15N5 — CID 133485202
5-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazine-2-carbonitrile (PubChem CID 133485202) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazine-2-carbonitrile.
| Compound Name | 5-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133485202 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-[1-(4-pyridin-3-ylphenyl)ethylamino]pyrazine-2-carbonitrile |
| SMILES | CC(Nc1cnc(C#N)cn1)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C18H15N5/c1-13(23-18-12-21-17(9-19)11-22-18)14-4-6-15(7-5-14)16-3-2-8-20-10-16/h2-8,10-13H,1H3,(H,22,23) |
| InChIKey | NCAYUHPQFROYAZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |