C24H28N4 — CID 130325370
N-(1-phenylethyl)-6-[4-(piperidin-1-ylmethyl)phenyl]pyrazin-2-amine (PubChem CID 130325370) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-(1-phenylethyl)-6-[4-(piperidin-1-ylmethyl)phenyl]pyrazin-2-amine.
| Compound Name | N-(1-phenylethyl)-6-[4-(piperidin-1-ylmethyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 130325370 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | N-(1-phenylethyl)-6-[4-(piperidin-1-ylmethyl)phenyl]pyrazin-2-amine |
| SMILES | CC(Nc1cncc(-c2ccc(CN3CCCCC3)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4/c1-19(21-8-4-2-5-9-21)26-24-17-25-16-23(27-24)22-12-10-20(11-13-22)18-28-14-6-3-7-15-28/h2,4-5,8-13,16-17,19H,3,6-7,14-15,18H2,1H3,(H,26,27) |
| InChIKey | URFQOGVLXZEYON-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |