C23H23N3O5 — CID 137307327
N-[2-[[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-4-methoxyphenyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 137307327) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[2-[[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-4-methoxyphenyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-4-methoxyphenyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 137307327 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[2-[[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-4-methoxyphenyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | COc1ccc(-c2cc(-c3cccc4c3OCO4)cc(NCCNC(C)=O)n2)c(O)c1 |
| InChI | InChI=1S/C23H23N3O5/c1-14(27)24-8-9-25-22-11-15(17-4-3-5-21-23(17)31-13-30-21)10-19(26-22)18-7-6-16(29-2)12-20(18)28/h3-7,10-12,28H,8-9,13H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | OAOJVQLVLYBDHQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|