C24H26ClFN2O3 — CID 137290865
2-[4-(4-chloro-3-fluorophenyl)-6-(3-propan-2-yloxypropylamino)-2-pyridinyl]-5-methoxyphenol (PubChem CID 137290865) has the molecular formula C24H26ClFN2O3 and a molecular weight of 444.93 g/mol. Its IUPAC name is 2-[4-(4-chloro-3-fluorophenyl)-6-(3-propan-2-yloxypropylamino)-2-pyridinyl]-5-methoxyphenol.
| Compound Name | 2-[4-(4-chloro-3-fluorophenyl)-6-(3-propan-2-yloxypropylamino)-2-pyridinyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 137290865 |
| Molecular Formula | C24H26ClFN2O3 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[4-(4-chloro-3-fluorophenyl)-6-(3-propan-2-yloxypropylamino)-2-pyridinyl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)c(F)c3)cc(NCCCOC(C)C)n2)c(O)c1 |
| InChI | InChI=1S/C24H26ClFN2O3/c1-15(2)31-10-4-9-27-24-13-17(16-5-8-20(25)21(26)11-16)12-22(28-24)19-7-6-18(30-3)14-23(19)29/h5-8,11-15,29H,4,9-10H2,1-3H3,(H,27,28) |
| InChIKey | DGHBYOFAEFROBZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|