C23H22ClFN2O3 — CID 137307091
2-[4-(2-chloro-6-fluorophenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-5-methoxyphenol (PubChem CID 137307091) has the molecular formula C23H22ClFN2O3 and a molecular weight of 428.89 g/mol. Its IUPAC name is 2-[4-(2-chloro-6-fluorophenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-5-methoxyphenol.
| Compound Name | 2-[4-(2-chloro-6-fluorophenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 137307091 |
| Molecular Formula | C23H22ClFN2O3 |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[4-(2-chloro-6-fluorophenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2cc(-c3c(F)cccc3Cl)cc(NCC3CCCO3)n2)c(O)c1 |
| InChI | InChI=1S/C23H22ClFN2O3/c1-29-15-7-8-17(21(28)12-15)20-10-14(23-18(24)5-2-6-19(23)25)11-22(27-20)26-13-16-4-3-9-30-16/h2,5-8,10-12,16,28H,3-4,9,13H2,1H3,(H,26,27) |
| InChIKey | CDXHSFDUHGPMFC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |