C23H26N2O3S — CID 137290520
4-[4-(5-ethylthiophen-2-yl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-2-methoxyphenol (PubChem CID 137290520) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[4-(5-ethylthiophen-2-yl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-2-methoxyphenol.
| Compound Name | 4-[4-(5-ethylthiophen-2-yl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 137290520 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[4-(5-ethylthiophen-2-yl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]-2-methoxyphenol |
| SMILES | CCc1ccc(-c2cc(NCC3CCCO3)nc(-c3ccc(O)c(OC)c3)c2)s1 |
| InChI | InChI=1S/C23H26N2O3S/c1-3-18-7-9-22(29-18)16-11-19(15-6-8-20(26)21(12-15)27-2)25-23(13-16)24-14-17-5-4-10-28-17/h6-9,11-13,17,26H,3-5,10,14H2,1-2H3,(H,24,25) |
| InChIKey | OAACMYREZFQKMR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |