C24H26N2O2S — CID 137290718
2-[4-(4-ethylsulfanylphenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]phenol (PubChem CID 137290718) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-[4-(4-ethylsulfanylphenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]phenol.
| Compound Name | 2-[4-(4-ethylsulfanylphenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 137290718 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[4-(4-ethylsulfanylphenyl)-6-(oxolan-2-ylmethylamino)-2-pyridinyl]phenol |
| SMILES | CCSc1ccc(-c2cc(NCC3CCCO3)nc(-c3ccccc3O)c2)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-2-29-20-11-9-17(10-12-20)18-14-22(21-7-3-4-8-23(21)27)26-24(15-18)25-16-19-6-5-13-28-19/h3-4,7-12,14-15,19,27H,2,5-6,13,16H2,1H3,(H,25,26) |
| InChIKey | CACXDXHSUCKSJU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |