About 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol
1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol (PubChem CID 137307121) has the molecular formula C23H22N2O4
and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol |
| PubChem CID | 137307121 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol |
| SMILES | Cc1ccc(O)c(-c2cc(-c3cccc4c3OCO4)cc(N3CCC(O)C3)n2)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-14-5-6-20(27)18(9-14)19-10-15(11-22(24-19)25-8-7-16(26)12-25)17-3-2-4-21-23(17)29-13-28-21/h2-6,9-11,16,26-27H,7-8,12-13H2,1H3 |
| InChIKey | CLGUDZCNEKWTHG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol?
The IUPAC name of 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol (CID 137307121) is 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol?
The canonical SMILES for 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol is Cc1ccc(O)c(-c2cc(-c3cccc4c3OCO4)cc(N3CCC(O)C3)n2)c1.
What is the InChIKey of 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol?
The InChIKey is CLGUDZCNEKWTHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O4/c1-14-5-6-20(27)18(9-14)19-10-15(11-22(24-19)25-8-7-16(26)12-25)17-3-2-4-21-23(17)29-13-28-21/h2-6,9-11,16,26-27H,7-8,12-13H2,1H3.
What are the key properties of 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol?
1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol has a molecular weight of 390.44 g/mol, XLogP of 3.73, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,3-benzodioxol-4-yl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]pyrrolidin-3-ol is sourced from PubChem (CID 137307121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).