C22H22FN3O3 — CID 137290687
N-[4-[2-(5-fluoro-2-hydroxyphenyl)-6-(3-hydroxypropylamino)-4-pyridinyl]phenyl]acetamide (PubChem CID 137290687) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[4-[2-(5-fluoro-2-hydroxyphenyl)-6-(3-hydroxypropylamino)-4-pyridinyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(5-fluoro-2-hydroxyphenyl)-6-(3-hydroxypropylamino)-4-pyridinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 137290687 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[4-[2-(5-fluoro-2-hydroxyphenyl)-6-(3-hydroxypropylamino)-4-pyridinyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cc(NCCCO)nc(-c3cc(F)ccc3O)c2)cc1 |
| InChI | InChI=1S/C22H22FN3O3/c1-14(28)25-18-6-3-15(4-7-18)16-11-20(19-13-17(23)5-8-21(19)29)26-22(12-16)24-9-2-10-27/h3-8,11-13,27,29H,2,9-10H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | WMCMCCHPQJMQNX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|