C24H29FN6O2 — CID 142680292
2-[2-amino-6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol (PubChem CID 142680292) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[2-amino-6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol.
| Compound Name | 2-[2-amino-6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol |
|---|---|
| PubChem CID | 142680292 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[2-amino-6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol |
| SMILES | Cc1ccc(Nc2ccc(O)c(-c3cc(NCCCN4CCOCC4)nc(N)n3)c2)c(F)c1 |
| InChI | InChI=1S/C24H29FN6O2/c1-16-3-5-20(19(25)13-16)28-17-4-6-22(32)18(14-17)21-15-23(30-24(26)29-21)27-7-2-8-31-9-11-33-12-10-31/h3-6,13-15,28,32H,2,7-12H2,1H3,(H3,26,27,29,30) |
| InChIKey | VFMQNESJVWDGGK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|