C15H25N5O2 — CID 126423060
4-N-(3-morpholin-4-ylpropyl)-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine (PubChem CID 126423060) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-N-(3-morpholin-4-ylpropyl)-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-morpholin-4-ylpropyl)-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 126423060 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 4-N-(3-morpholin-4-ylpropyl)-6-[(3R)-oxolan-3-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCCN2CCOCC2)cc([C@H]2CCOC2)n1 |
| InChI | InChI=1S/C15H25N5O2/c16-15-18-13(12-2-7-22-11-12)10-14(19-15)17-3-1-4-20-5-8-21-9-6-20/h10,12H,1-9,11H2,(H3,16,17,18,19)/t12-/m0/s1 |
| InChIKey | SQFGWJMFGNOEFQ-LBPRGKRZSA-N |
| XLogP | 0.70 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|