C15H19N5O3S — CID 126449866
4-[[[2-amino-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]methyl]benzenesulfonamide (PubChem CID 126449866) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is 4-[[[2-amino-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[2-amino-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126449866 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[[[2-amino-6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]methyl]benzenesulfonamide |
| SMILES | Nc1nc(NCc2ccc(S(N)(=O)=O)cc2)cc([C@H]2CCOC2)n1 |
| InChI | InChI=1S/C15H19N5O3S/c16-15-19-13(11-5-6-23-9-11)7-14(20-15)18-8-10-1-3-12(4-2-10)24(17,21)22/h1-4,7,11H,5-6,8-9H2,(H2,17,21,22)(H3,16,18,19,20)/t11-/m0/s1 |
| InChIKey | NGYIXIKMRDIZMA-NSHDSACASA-N |
| XLogP | 0.82 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |