C23H20FN5O — CID 142680330
2-(2-amino-6-anilinopyrimidin-4-yl)-4-(2-fluoro-4-methylanilino)phenol (PubChem CID 142680330) has the molecular formula C23H20FN5O and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-(2-amino-6-anilinopyrimidin-4-yl)-4-(2-fluoro-4-methylanilino)phenol.
| Compound Name | 2-(2-amino-6-anilinopyrimidin-4-yl)-4-(2-fluoro-4-methylanilino)phenol |
|---|---|
| PubChem CID | 142680330 |
| Molecular Formula | C23H20FN5O |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-(2-amino-6-anilinopyrimidin-4-yl)-4-(2-fluoro-4-methylanilino)phenol |
| SMILES | Cc1ccc(Nc2ccc(O)c(-c3cc(Nc4ccccc4)nc(N)n3)c2)c(F)c1 |
| InChI | InChI=1S/C23H20FN5O/c1-14-7-9-19(18(24)11-14)26-16-8-10-21(30)17(12-16)20-13-22(29-23(25)28-20)27-15-5-3-2-4-6-15/h2-13,26,30H,1H3,(H3,25,27,28,29) |
| InChIKey | GIECOXFWBPDJOF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|