C12H12FN3 — CID 80646846
6-N-(2-fluoro-4-methylphenyl)pyridine-2,6-diamine (PubChem CID 80646846) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 6-N-(2-fluoro-4-methylphenyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(2-fluoro-4-methylphenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80646846 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 6-N-(2-fluoro-4-methylphenyl)pyridine-2,6-diamine |
| SMILES | Cc1ccc(Nc2cccc(N)n2)c(F)c1 |
| InChI | InChI=1S/C12H12FN3/c1-8-5-6-10(9(13)7-8)15-12-4-2-3-11(14)16-12/h2-7H,1H3,(H3,14,15,16) |
| InChIKey | IXWNIEULLLDELX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |