C11H9ClFN3 — CID 80653049
6-N-(4-chloro-2-fluorophenyl)pyridine-2,6-diamine (PubChem CID 80653049) has the molecular formula C11H9ClFN3 and a molecular weight of 237.67 g/mol. Its IUPAC name is 6-N-(4-chloro-2-fluorophenyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(4-chloro-2-fluorophenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80653049 |
| Molecular Formula | C11H9ClFN3 |
| Molecular Weight | 237.67 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 6-N-(4-chloro-2-fluorophenyl)pyridine-2,6-diamine |
| SMILES | Nc1cccc(Nc2ccc(Cl)cc2F)n1 |
| InChI | InChI=1S/C11H9ClFN3/c12-7-4-5-9(8(13)6-7)15-11-3-1-2-10(14)16-11/h1-6H,(H3,14,15,16) |
| InChIKey | HINHCJQIJWDHCC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |