C24H28FN5O — CID 142680289
4-(2-fluoro-4-methylanilino)-2-[2-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]phenol (PubChem CID 142680289) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylanilino)-2-[2-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]phenol.
| Compound Name | 4-(2-fluoro-4-methylanilino)-2-[2-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 142680289 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-(2-fluoro-4-methylanilino)-2-[2-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]phenol |
| SMILES | Cc1ccc(Nc2ccc(O)c(-c3ccnc(NCCN4CCCCC4)n3)c2)c(F)c1 |
| InChI | InChI=1S/C24H28FN5O/c1-17-5-7-22(20(25)15-17)28-18-6-8-23(31)19(16-18)21-9-10-26-24(29-21)27-11-14-30-12-3-2-4-13-30/h5-10,15-16,28,31H,2-4,11-14H2,1H3,(H,26,27,29) |
| InChIKey | QGKFIDMDZCISSC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|