C20H22FN5O2 — CID 142680334
2-[2-amino-6-(1-hydroxypropan-2-ylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol (PubChem CID 142680334) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-[2-amino-6-(1-hydroxypropan-2-ylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol.
| Compound Name | 2-[2-amino-6-(1-hydroxypropan-2-ylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol |
|---|---|
| PubChem CID | 142680334 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[2-amino-6-(1-hydroxypropan-2-ylamino)pyrimidin-4-yl]-4-(2-fluoro-4-methylanilino)phenol |
| SMILES | Cc1ccc(Nc2ccc(O)c(-c3cc(NC(C)CO)nc(N)n3)c2)c(F)c1 |
| InChI | InChI=1S/C20H22FN5O2/c1-11-3-5-16(15(21)7-11)24-13-4-6-18(28)14(8-13)17-9-19(23-12(2)10-27)26-20(22)25-17/h3-9,12,24,27-28H,10H2,1-2H3,(H3,22,23,25,26) |
| InChIKey | YCOMOMFIJATITG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|