C22H25N5O3 — CID 135433099
2-[2-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-4-(4-hydroxyphenyl)phenol (PubChem CID 135433099) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[2-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-4-(4-hydroxyphenyl)phenol.
| Compound Name | 2-[2-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-4-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 135433099 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[2-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-4-(4-hydroxyphenyl)phenol |
| SMILES | Nc1nc(NCCN2CCOCC2)cc(-c2cc(-c3ccc(O)cc3)ccc2O)n1 |
| InChI | InChI=1S/C22H25N5O3/c23-22-25-19(14-21(26-22)24-7-8-27-9-11-30-12-10-27)18-13-16(3-6-20(18)29)15-1-4-17(28)5-2-15/h1-6,13-14,28-29H,7-12H2,(H3,23,24,25,26) |
| InChIKey | HSVMDGOACYDAOL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |