C21H21FN2O — CID 137306873
2-[4-(3-fluorophenyl)-6-(propan-2-ylamino)-2-pyridinyl]-4-methylphenol (PubChem CID 137306873) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[4-(3-fluorophenyl)-6-(propan-2-ylamino)-2-pyridinyl]-4-methylphenol.
| Compound Name | 2-[4-(3-fluorophenyl)-6-(propan-2-ylamino)-2-pyridinyl]-4-methylphenol |
|---|---|
| PubChem CID | 137306873 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[4-(3-fluorophenyl)-6-(propan-2-ylamino)-2-pyridinyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(-c2cc(-c3cccc(F)c3)cc(NC(C)C)n2)c1 |
| InChI | InChI=1S/C21H21FN2O/c1-13(2)23-21-12-16(15-5-4-6-17(22)10-15)11-19(24-21)18-9-14(3)7-8-20(18)25/h4-13,25H,1-3H3,(H,23,24) |
| InChIKey | YIEBGFKAUBTKGL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |