C16H16ClNO3 — CID 82453435
3-[6-(3-chloro-4-methoxyphenyl)-2-methyl-3-pyridinyl]propanoic acid (PubChem CID 82453435) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 3-[6-(3-chloro-4-methoxyphenyl)-2-methyl-3-pyridinyl]propanoic acid.
| Compound Name | 3-[6-(3-chloro-4-methoxyphenyl)-2-methyl-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 82453435 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[6-(3-chloro-4-methoxyphenyl)-2-methyl-3-pyridinyl]propanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(=O)O)c(C)n2)cc1Cl |
| InChI | InChI=1S/C16H16ClNO3/c1-10-11(5-8-16(19)20)3-6-14(18-10)12-4-7-15(21-2)13(17)9-12/h3-4,6-7,9H,5,8H2,1-2H3,(H,19,20) |
| InChIKey | GMKRLWPDQZQAME-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |