2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid

C11H9ClN2O4 — CID 82134188

IUPAC2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid
SMILESCOc1ccc(-c2nnc(CC(=O)O)o2)cc1Cl
InChIInChI=1S/C11H9ClN2O4/c1-17-8-3-2-6(4-7(8)12)11-14-13-9(18-11)5-10(15)16/h2-4H,5H2,1H3,(H,15,16)
InChIKeyLMTCPZPSSTZTPW-UHFFFAOYSA-N
MW268.66 g/mol
LogP2.03
Rot. Bonds4

About 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid

2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid (PubChem CID 82134188) has the molecular formula C11H9ClN2O4 and a molecular weight of 268.66 g/mol. Its IUPAC name is 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid
PubChem CID82134188
Molecular FormulaC11H9ClN2O4
Molecular Weight268.66 g/mol
Exact Mass268.03
IUPAC Name2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid
SMILESCOc1ccc(-c2nnc(CC(=O)O)o2)cc1Cl
InChIInChI=1S/C11H9ClN2O4/c1-17-8-3-2-6(4-7(8)12)11-14-13-9(18-11)5-10(15)16/h2-4H,5H2,1H3,(H,15,16)
InChIKeyLMTCPZPSSTZTPW-UHFFFAOYSA-N
XLogP2.03
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.66
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid?
The IUPAC name of 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid (CID 82134188) is 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid.
What is the SMILES notation for 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid?
The canonical SMILES for 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid is COc1ccc(-c2nnc(CC(=O)O)o2)cc1Cl.
What is the InChIKey of 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid?
The InChIKey is LMTCPZPSSTZTPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O4/c1-17-8-3-2-6(4-7(8)12)11-14-13-9(18-11)5-10(15)16/h2-4H,5H2,1H3,(H,15,16).
What are the key properties of 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid?
2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid has a molecular weight of 268.66 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3-chloro-4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]acetic acid is sourced from PubChem (CID 82134188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).