C15H16Cl2N2 — CID 82452828
2-[6-(2,5-dichlorophenyl)-2-methyl-3-pyridinyl]propan-2-amine (PubChem CID 82452828) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 2-[6-(2,5-dichlorophenyl)-2-methyl-3-pyridinyl]propan-2-amine.
| Compound Name | 2-[6-(2,5-dichlorophenyl)-2-methyl-3-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 82452828 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[6-(2,5-dichlorophenyl)-2-methyl-3-pyridinyl]propan-2-amine |
| SMILES | Cc1nc(-c2cc(Cl)ccc2Cl)ccc1C(C)(C)N |
| InChI | InChI=1S/C15H16Cl2N2/c1-9-12(15(2,3)18)5-7-14(19-9)11-8-10(16)4-6-13(11)17/h4-8H,18H2,1-3H3 |
| InChIKey | YAGJDZSZQHZCCA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |