C13H14Cl2N2S — CID 2507086
N-tert-butyl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 2507086) has the molecular formula C13H14Cl2N2S and a molecular weight of 301.24 g/mol. Its IUPAC name is N-tert-butyl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-tert-butyl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2507086 |
| Molecular Formula | C13H14Cl2N2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-tert-butyl-4-(2,5-dichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)Nc1nc(-c2cc(Cl)ccc2Cl)cs1 |
| InChI | InChI=1S/C13H14Cl2N2S/c1-13(2,3)17-12-16-11(7-18-12)9-6-8(14)4-5-10(9)15/h4-7H,1-3H3,(H,16,17) |
| InChIKey | YYYAHKTZOOUCOH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |