C18H14Cl2N2O3S — CID 4181945
N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide (PubChem CID 4181945) has the molecular formula C18H14Cl2N2O3S and a molecular weight of 409.29 g/mol. Its IUPAC name is N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 4181945 |
| Molecular Formula | C18H14Cl2N2O3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1nc(-c2cc(Cl)ccc2Cl)cs1 |
| InChI | InChI=1S/C18H14Cl2N2O3S/c1-24-14-4-3-5-15(25-2)16(14)17(23)22-18-21-13(9-26-18)11-8-10(19)6-7-12(11)20/h3-9H,1-2H3,(H,21,22,23) |
| InChIKey | RHTXXEFZUQOACL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |