C16H13ClN2O3S2 — CID 4224171
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide (PubChem CID 4224171) has the molecular formula C16H13ClN2O3S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 4224171 |
| Molecular Formula | C16H13ClN2O3S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C16H13ClN2O3S2/c1-21-10-4-3-5-11(22-2)14(10)15(20)19-16-18-9(8-23-16)12-6-7-13(17)24-12/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | ZDNSYXCVFUKJBL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |