C18H14Cl2N2OS — CID 4517277
2,6-dichloro-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4517277) has the molecular formula C18H14Cl2N2OS and a molecular weight of 377.30 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4517277 |
| Molecular Formula | C18H14Cl2N2OS |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2,6-dichloro-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3c(Cl)cccc3Cl)n2)c(C)c1 |
| InChI | InChI=1S/C18H14Cl2N2OS/c1-10-6-7-12(11(2)8-10)15-9-24-18(21-15)22-17(23)16-13(19)4-3-5-14(16)20/h3-9H,1-2H3,(H,21,22,23) |
| InChIKey | GYMVGRQREKCZPF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |