C16H17Cl2N3OS — CID 121080414
1-cyclohexyl-3-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]urea (PubChem CID 121080414) has the molecular formula C16H17Cl2N3OS and a molecular weight of 370.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 121080414 |
| Molecular Formula | C16H17Cl2N3OS |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 1-cyclohexyl-3-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1nc(-c2cc(Cl)ccc2Cl)cs1)NC1CCCCC1 |
| InChI | InChI=1S/C16H17Cl2N3OS/c17-10-6-7-13(18)12(8-10)14-9-23-16(20-14)21-15(22)19-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H2,19,20,21,22) |
| InChIKey | UPRPCYINAWUCTJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |