C20H19Cl2N3O3S — CID 112793771
N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide (PubChem CID 112793771) has the molecular formula C20H19Cl2N3O3S and a molecular weight of 452.36 g/mol. Its IUPAC name is N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide.
| Compound Name | N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 112793771 |
| Molecular Formula | C20H19Cl2N3O3S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1nc(-c2cc(Cl)ccc2Cl)cs1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C20H19Cl2N3O3S/c1-10(25-18(27)12-4-2-3-5-13(12)19(25)28)17(26)24-20-23-16(9-29-20)14-8-11(21)6-7-15(14)22/h6-10,12-13H,2-5H2,1H3,(H,23,24,26) |
| InChIKey | DHQVPFSEIAMROQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|