C9H16N2 — CID 142906419
2,6-dimethylpyridin-3-amine;ethane (PubChem CID 142906419) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,6-dimethylpyridin-3-amine;ethane.
| Compound Name | 2,6-dimethylpyridin-3-amine;ethane |
|---|---|
| PubChem CID | 142906419 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,6-dimethylpyridin-3-amine;ethane |
| SMILES | CC.Cc1ccc(N)c(C)n1 |
| InChI | InChI=1S/C7H10N2.C2H6/c1-5-3-4-7(8)6(2)9-5;1-2/h3-4H,8H2,1-2H3;1-2H3 |
| InChIKey | AWIYUNGAGBYKJT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |