C10H12N6 — CID 112681460
6-(2,6-dimethyl-3-pyridinyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681460) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 6-(2,6-dimethyl-3-pyridinyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,6-dimethyl-3-pyridinyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681460 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 6-(2,6-dimethyl-3-pyridinyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nc(N)nc(N)n2)c(C)n1 |
| InChI | InChI=1S/C10H12N6/c1-5-3-4-7(6(2)13-5)8-14-9(11)16-10(12)15-8/h3-4H,1-2H3,(H4,11,12,14,15,16) |
| InChIKey | JSPNELCYXZYHIE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |