C19H20N4 — CID 155659770
4,6-bis(2,3-dimethylphenyl)-1,3,5-triazin-2-amine (PubChem CID 155659770) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 4,6-bis(2,3-dimethylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(2,3-dimethylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 155659770 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4,6-bis(2,3-dimethylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(-c2nc(N)nc(-c3cccc(C)c3C)n2)c1C |
| InChI | InChI=1S/C19H20N4/c1-11-7-5-9-15(13(11)3)17-21-18(23-19(20)22-17)16-10-6-8-12(2)14(16)4/h5-10H,1-4H3,(H2,20,21,22,23) |
| InChIKey | GMHRWRPTBTZLBD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |