C10H8ClFN4 — CID 83240116
4-chloro-6-(2-fluoro-3-methylphenyl)-1,3,5-triazin-2-amine (PubChem CID 83240116) has the molecular formula C10H8ClFN4 and a molecular weight of 238.65 g/mol. Its IUPAC name is 4-chloro-6-(2-fluoro-3-methylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(2-fluoro-3-methylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83240116 |
| Molecular Formula | C10H8ClFN4 |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-chloro-6-(2-fluoro-3-methylphenyl)-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(-c2nc(N)nc(Cl)n2)c1F |
| InChI | InChI=1S/C10H8ClFN4/c1-5-3-2-4-6(7(5)12)8-14-9(11)16-10(13)15-8/h2-4H,1H3,(H2,13,14,15,16) |
| InChIKey | YGGJWSLFTCJQJM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |