C11H13N5 — CID 25163924
6-(2,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 25163924) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25163924 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nc(N)nc(N)n2)c(C)c1 |
| InChI | InChI=1S/C11H13N5/c1-6-3-4-8(7(2)5-6)9-14-10(12)16-11(13)15-9/h3-5H,1-2H3,(H4,12,13,14,15,16) |
| InChIKey | DJTGOSZVMBGNNV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |