C10H11N5O — CID 112681318
3-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylphenol (PubChem CID 112681318) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylphenol.
| Compound Name | 3-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylphenol |
|---|---|
| PubChem CID | 112681318 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylphenol |
| SMILES | Cc1c(O)cccc1-c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C10H11N5O/c1-5-6(3-2-4-7(5)16)8-13-9(11)15-10(12)14-8/h2-4,16H,1H3,(H4,11,12,13,14,15) |
| InChIKey | RWILHJUUBQUUPQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |