C9H14FN — CID 143091360
ethane;3-fluoro-2,6-dimethylpyridine (PubChem CID 143091360) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is ethane;3-fluoro-2,6-dimethylpyridine.
| Compound Name | ethane;3-fluoro-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 143091360 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | ethane;3-fluoro-2,6-dimethylpyridine |
| SMILES | CC.Cc1ccc(F)c(C)n1 |
| InChI | InChI=1S/C7H8FN.C2H6/c1-5-3-4-7(8)6(2)9-5;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | KCIHNJXWFMGQLH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |