C14H6Cl3F5 — CID 134631103
1,2,4-trichloro-5-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]benzene (PubChem CID 134631103) has the molecular formula C14H6Cl3F5 and a molecular weight of 375.55 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2,4-trichloro-5-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134631103 |
| Molecular Formula | C14H6Cl3F5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 1,2,4-trichloro-5-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]benzene |
| SMILES | FC(F)c1cccc(C(F)(F)F)c1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H6Cl3F5/c15-9-5-11(17)10(16)4-7(9)12-6(13(18)19)2-1-3-8(12)14(20,21)22/h1-5,13H |
| InChIKey | OPRVOCMSCHJROY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|