C9H5ClF3N3 — CID 10514665
5-chloro-7-(trifluoromethyl)-1,8-naphthyridin-2-amine (PubChem CID 10514665) has the molecular formula C9H5ClF3N3 and a molecular weight of 247.61 g/mol. Its IUPAC name is 5-chloro-7-(trifluoromethyl)-1,8-naphthyridin-2-amine.
| Compound Name | 5-chloro-7-(trifluoromethyl)-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 10514665 |
| Molecular Formula | C9H5ClF3N3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 5-chloro-7-(trifluoromethyl)-1,8-naphthyridin-2-amine |
| SMILES | Nc1ccc2c(Cl)cc(C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C9H5ClF3N3/c10-5-3-6(9(11,12)13)15-8-4(5)1-2-7(14)16-8/h1-3H,(H2,14,15,16) |
| InChIKey | HDUVSZOJUPMSIX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |