C11H6Cl2F2N2 — CID 114275267
5-chloro-3-(6-chloro-2,3-difluorophenyl)pyridin-2-amine (PubChem CID 114275267) has the molecular formula C11H6Cl2F2N2 and a molecular weight of 275.09 g/mol. Its IUPAC name is 5-chloro-3-(6-chloro-2,3-difluorophenyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-(6-chloro-2,3-difluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114275267 |
| Molecular Formula | C11H6Cl2F2N2 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 5-chloro-3-(6-chloro-2,3-difluorophenyl)pyridin-2-amine |
| SMILES | Nc1ncc(Cl)cc1-c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C11H6Cl2F2N2/c12-5-3-6(11(16)17-4-5)9-7(13)1-2-8(14)10(9)15/h1-4H,(H2,16,17) |
| InChIKey | VWKFRCNMNDEKTL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|