C12H9BrClF2N3 — CID 107538682
3-[amino-(2-bromo-3,4-difluorophenyl)methyl]-5-chloropyridin-2-amine (PubChem CID 107538682) has the molecular formula C12H9BrClF2N3 and a molecular weight of 348.58 g/mol. Its IUPAC name is 3-[amino-(2-bromo-3,4-difluorophenyl)methyl]-5-chloropyridin-2-amine.
| Compound Name | 3-[amino-(2-bromo-3,4-difluorophenyl)methyl]-5-chloropyridin-2-amine |
|---|---|
| PubChem CID | 107538682 |
| Molecular Formula | C12H9BrClF2N3 |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 3-[amino-(2-bromo-3,4-difluorophenyl)methyl]-5-chloropyridin-2-amine |
| SMILES | Nc1ncc(Cl)cc1C(N)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C12H9BrClF2N3/c13-9-6(1-2-8(15)10(9)16)11(17)7-3-5(14)4-19-12(7)18/h1-4,11H,17H2,(H2,18,19) |
| InChIKey | WVRYVVQWCCIIQY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|