C12H10BrF2N3O — CID 107538859
(2-bromo-3,4-difluorophenyl)-(3-methoxypyrazin-2-yl)methanamine (PubChem CID 107538859) has the molecular formula C12H10BrF2N3O and a molecular weight of 330.13 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(3-methoxypyrazin-2-yl)methanamine.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(3-methoxypyrazin-2-yl)methanamine |
|---|---|
| PubChem CID | 107538859 |
| Molecular Formula | C12H10BrF2N3O |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(3-methoxypyrazin-2-yl)methanamine |
| SMILES | COc1nccnc1C(N)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C12H10BrF2N3O/c1-19-12-11(17-4-5-18-12)10(16)6-2-3-7(14)9(15)8(6)13/h2-5,10H,16H2,1H3 |
| InChIKey | DMPIVHWTRMZFLC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|