C12H7Cl3N2O — CID 81492506
(2-amino-5-chloro-3-pyridinyl)-(3,4-dichlorophenyl)methanone (PubChem CID 81492506) has the molecular formula C12H7Cl3N2O and a molecular weight of 301.56 g/mol. Its IUPAC name is (2-amino-5-chloro-3-pyridinyl)-(3,4-dichlorophenyl)methanone.
| Compound Name | (2-amino-5-chloro-3-pyridinyl)-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 81492506 |
| Molecular Formula | C12H7Cl3N2O |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | (2-amino-5-chloro-3-pyridinyl)-(3,4-dichlorophenyl)methanone |
| SMILES | Nc1ncc(Cl)cc1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl3N2O/c13-7-4-8(12(16)17-5-7)11(18)6-1-2-9(14)10(15)3-6/h1-5H,(H2,16,17) |
| InChIKey | FCQXTRZQBJDKKQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |