C7H4Cl2F2N2O — CID 112574914
1-(2-amino-5-chloro-3-pyridinyl)-2-chloro-2,2-difluoroethanone (PubChem CID 112574914) has the molecular formula C7H4Cl2F2N2O and a molecular weight of 241.02 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-pyridinyl)-2-chloro-2,2-difluoroethanone.
| Compound Name | 1-(2-amino-5-chloro-3-pyridinyl)-2-chloro-2,2-difluoroethanone |
|---|---|
| PubChem CID | 112574914 |
| Molecular Formula | C7H4Cl2F2N2O |
| Molecular Weight | 241.02 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 1-(2-amino-5-chloro-3-pyridinyl)-2-chloro-2,2-difluoroethanone |
| SMILES | Nc1ncc(Cl)cc1C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C7H4Cl2F2N2O/c8-3-1-4(6(12)13-2-3)5(14)7(9,10)11/h1-2H,(H2,12,13) |
| InChIKey | YITSOQWKRMWRDT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.02 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|